About 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride
3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride (PubChem CID 11971083) has the molecular formula C10H22ClNO
and a molecular weight of 207.74 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride |
| PubChem CID | 11971083 |
| Molecular Formula | C10H22ClNO |
| Molecular Weight | 207.74 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride |
| SMILES | CC1CCCC(C)N1CCCO.Cl |
| InChI | InChI=1S/C10H21NO.ClH/c1-9-5-3-6-10(2)11(9)7-4-8-12;/h9-10,12H,3-8H2,1-2H3;1H |
| InChIKey | JARCPODAOOKYEO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride?
The IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride (CID 11971083) is 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride.
What is the SMILES notation for 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride?
The canonical SMILES for 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride is CC1CCCC(C)N1CCCO.Cl.
What is the InChIKey of 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride?
The InChIKey is JARCPODAOOKYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.ClH/c1-9-5-3-6-10(2)11(9)7-4-8-12;/h9-10,12H,3-8H2,1-2H3;1H.
What are the key properties of 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride?
3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride has a molecular weight of 207.74 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylpiperidin-1-yl)propan-1-ol;hydrochloride is sourced from PubChem (CID 11971083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).