About 2-methyl-1,4-dioxecane-5,10-dione
2-methyl-1,4-dioxecane-5,10-dione (PubChem CID 11971122) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-methyl-1,4-dioxecane-5,10-dione.
Molecular Properties
| Compound Name | 2-methyl-1,4-dioxecane-5,10-dione |
| PubChem CID | 11971122 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-methyl-1,4-dioxecane-5,10-dione |
| SMILES | CC1COC(=O)CCCCC(=O)O1 |
| InChI | InChI=1S/C9H14O4/c1-7-6-12-8(10)4-2-3-5-9(11)13-7/h7H,2-6H2,1H3 |
| InChIKey | VGHCVSPDKSEROA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1,4-dioxecane-5,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-dioxecane-5,10-dione?
The IUPAC name of 2-methyl-1,4-dioxecane-5,10-dione (CID 11971122) is 2-methyl-1,4-dioxecane-5,10-dione.
What is the SMILES notation for 2-methyl-1,4-dioxecane-5,10-dione?
The canonical SMILES for 2-methyl-1,4-dioxecane-5,10-dione is CC1COC(=O)CCCCC(=O)O1.
What is the InChIKey of 2-methyl-1,4-dioxecane-5,10-dione?
The InChIKey is VGHCVSPDKSEROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-7-6-12-8(10)4-2-3-5-9(11)13-7/h7H,2-6H2,1H3.
What are the key properties of 2-methyl-1,4-dioxecane-5,10-dione?
2-methyl-1,4-dioxecane-5,10-dione has a molecular weight of 186.21 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-dioxecane-5,10-dione is sourced from PubChem (CID 11971122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).