About 4-methylidene-2-propyl-1,3-dioxane
4-methylidene-2-propyl-1,3-dioxane (PubChem CID 11971173) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-methylidene-2-propyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-methylidene-2-propyl-1,3-dioxane |
| PubChem CID | 11971173 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4-methylidene-2-propyl-1,3-dioxane |
| SMILES | C=C1CCOC(CCC)O1 |
| InChI | InChI=1S/C8H14O2/c1-3-4-8-9-6-5-7(2)10-8/h8H,2-6H2,1H3 |
| InChIKey | FAGLUDRGGWLUKA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylidene-2-propyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-2-propyl-1,3-dioxane?
The IUPAC name of 4-methylidene-2-propyl-1,3-dioxane (CID 11971173) is 4-methylidene-2-propyl-1,3-dioxane.
What is the SMILES notation for 4-methylidene-2-propyl-1,3-dioxane?
The canonical SMILES for 4-methylidene-2-propyl-1,3-dioxane is C=C1CCOC(CCC)O1.
What is the InChIKey of 4-methylidene-2-propyl-1,3-dioxane?
The InChIKey is FAGLUDRGGWLUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-8-9-6-5-7(2)10-8/h8H,2-6H2,1H3.
What are the key properties of 4-methylidene-2-propyl-1,3-dioxane?
4-methylidene-2-propyl-1,3-dioxane has a molecular weight of 142.20 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-2-propyl-1,3-dioxane is sourced from PubChem (CID 11971173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).