C20H27ClN2O2 — CID 119712185
(2S)-2-amino-4-methyl-N-[(4-phenylmethoxyphenyl)methyl]pentanamide;hydrochloride (PubChem CID 119712185) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(4-phenylmethoxyphenyl)methyl]pentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-methyl-N-[(4-phenylmethoxyphenyl)methyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119712185 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(4-phenylmethoxyphenyl)methyl]pentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)NCc1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H26N2O2.ClH/c1-15(2)12-19(21)20(23)22-13-16-8-10-18(11-9-16)24-14-17-6-4-3-5-7-17;/h3-11,15,19H,12-14,21H2,1-2H3,(H,22,23);1H/t19-;/m0./s1 |
| InChIKey | SZYLMOLXJIYNNY-FYZYNONXSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |