C15H25N3OS — CID 119713639
(2S)-2-amino-N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanamide (PubChem CID 119713639) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119713639 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (2S)-2-amino-N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanamide |
| SMILES | CCC1CCc2nc(NC(=O)[C@@H](N)C(C)(C)C)sc2C1 |
| InChI | InChI=1S/C15H25N3OS/c1-5-9-6-7-10-11(8-9)20-14(17-10)18-13(19)12(16)15(2,3)4/h9,12H,5-8,16H2,1-4H3,(H,17,18,19)/t9?,12-/m1/s1 |
| InChIKey | QUUUUMJEJVEJAC-FFFFSGIJSA-N |
| XLogP | 2.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |