C14H20ClN3O2 — CID 119714145
N-[4-(ethylcarbamoyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119714145) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is N-[4-(ethylcarbamoyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-(ethylcarbamoyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119714145 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[4-(ethylcarbamoyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc(NC(=O)C2CCNC2)cc1.Cl |
| InChI | InChI=1S/C14H19N3O2.ClH/c1-2-16-13(18)10-3-5-12(6-4-10)17-14(19)11-7-8-15-9-11;/h3-6,11,15H,2,7-9H2,1H3,(H,16,18)(H,17,19);1H |
| InChIKey | RZYAHXAFZBBCFE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |