About 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride
5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride (PubChem CID 11971453) has the molecular formula C8H9Cl2N3OS
and a molecular weight of 266.15 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride |
| PubChem CID | 11971453 |
| Molecular Formula | C8H9Cl2N3OS |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride |
| SMILES | Cl.Nc1nnc(-c2ccccc2Cl)s1.O |
| InChI | InChI=1S/C8H6ClN3S.ClH.H2O/c9-6-4-2-1-3-5(6)7-11-12-8(10)13-7;;/h1-4H,(H2,10,12);1H;1H2 |
| InChIKey | VIVXSYPGDUOKDP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The IUPAC name of 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride (CID 11971453) is 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride.
What is the SMILES notation for 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The canonical SMILES for 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride is Cl.Nc1nnc(-c2ccccc2Cl)s1.O.
What is the InChIKey of 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The InChIKey is VIVXSYPGDUOKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3S.ClH.H2O/c9-6-4-2-1-3-5(6)7-11-12-8(10)13-7;;/h1-4H,(H2,10,12);1H;1H2.
What are the key properties of 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride has a molecular weight of 266.15 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride is sourced from PubChem (CID 11971453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).