About 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride
5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride (PubChem CID 11971459) has the molecular formula C6H8ClN3OS2
and a molecular weight of 237.74 g/mol. Its IUPAC name is 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride |
| PubChem CID | 11971459 |
| Molecular Formula | C6H8ClN3OS2 |
| Molecular Weight | 237.74 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride |
| SMILES | Cl.Nc1nnc(-c2cccs2)s1.O |
| InChI | InChI=1S/C6H5N3S2.ClH.H2O/c7-6-9-8-5(11-6)4-2-1-3-10-4;;/h1-3H,(H2,7,9);1H;1H2 |
| InChIKey | VGDQXNBGRIYDHP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The IUPAC name of 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride (CID 11971459) is 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride.
What is the SMILES notation for 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The canonical SMILES for 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride is Cl.Nc1nnc(-c2cccs2)s1.O.
What is the InChIKey of 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
The InChIKey is VGDQXNBGRIYDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S2.ClH.H2O/c7-6-9-8-5(11-6)4-2-1-3-10-4;;/h1-3H,(H2,7,9);1H;1H2.
What are the key properties of 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride?
5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride has a molecular weight of 237.74 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thiophen-2-yl-1,3,4-thiadiazol-2-amine;hydrate;hydrochloride is sourced from PubChem (CID 11971459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).