About 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride
5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride (PubChem CID 11971460) has the molecular formula C9H10ClN3S
and a molecular weight of 227.72 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride |
| PubChem CID | 11971460 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride |
| SMILES | Cc1ccccc1-c1nnc(N)s1.Cl |
| InChI | InChI=1S/C9H9N3S.ClH/c1-6-4-2-3-5-7(6)8-11-12-9(10)13-8;/h2-5H,1H3,(H2,10,12);1H |
| InChIKey | OXBXUJABCFGVGU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride?
The IUPAC name of 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride (CID 11971460) is 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride?
The canonical SMILES for 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride is Cc1ccccc1-c1nnc(N)s1.Cl.
What is the InChIKey of 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride?
The InChIKey is OXBXUJABCFGVGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S.ClH/c1-6-4-2-3-5-7(6)8-11-12-9(10)13-8;/h2-5H,1H3,(H2,10,12);1H.
What are the key properties of 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride?
5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride has a molecular weight of 227.72 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylphenyl)-1,3,4-thiadiazol-2-amine;hydrochloride is sourced from PubChem (CID 11971460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).