About propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate
propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate (PubChem CID 11971580) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate |
| PubChem CID | 11971580 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate |
| SMILES | COC(C)(C)CCCC(C)CC1OC1/C(C)=C/C(=O)OC(C)C |
| InChI | InChI=1S/C19H34O4/c1-13(2)22-17(20)12-15(4)18-16(23-18)11-14(3)9-8-10-19(5,6)21-7/h12-14,16,18H,8-11H2,1-7H3/b15-12+ |
| InChIKey | MJAXFRRFHMMZEL-NTCAYCPXSA-N |
| XLogP | 4.27 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate?
The IUPAC name of propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate (CID 11971580) is propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate.
What is the SMILES notation for propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate?
The canonical SMILES for propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate is COC(C)(C)CCCC(C)CC1OC1/C(C)=C/C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate?
The InChIKey is MJAXFRRFHMMZEL-NTCAYCPXSA-N. The full InChI is InChI=1S/C19H34O4/c1-13(2)22-17(20)12-15(4)18-16(23-18)11-14(3)9-8-10-19(5,6)21-7/h12-14,16,18H,8-11H2,1-7H3/b15-12+.
What are the key properties of propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate?
propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate has a molecular weight of 326.48 g/mol, XLogP of 4.27, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E)-3-[3-(6-methoxy-2,6-dimethylheptyl)oxiran-2-yl]but-2-enoate is sourced from PubChem (CID 11971580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).