C17H24ClN3O2 — CID 119715831
N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119715831) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119715831 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(NC(=O)C2CCNC2)c1C(=O)N1CCCC1.Cl |
| InChI | InChI=1S/C17H23N3O2.ClH/c1-12-5-4-6-14(19-16(21)13-7-8-18-11-13)15(12)17(22)20-9-2-3-10-20;/h4-6,13,18H,2-3,7-11H2,1H3,(H,19,21);1H |
| InChIKey | LKWQPPZZNYUITI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |