C21H28Cl3N3O — CID 11971642
2-[benzyl(2-pyrrolidin-1-ylethyl)amino]-N-(2-chlorophenyl)acetamide;dihydrochloride (PubChem CID 11971642) has the molecular formula C21H28Cl3N3O and a molecular weight of 444.83 g/mol. Its IUPAC name is 2-[benzyl(2-pyrrolidin-1-ylethyl)amino]-N-(2-chlorophenyl)acetamide;dihydrochloride.
| Compound Name | 2-[benzyl(2-pyrrolidin-1-ylethyl)amino]-N-(2-chlorophenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 11971642 |
| Molecular Formula | C21H28Cl3N3O |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[benzyl(2-pyrrolidin-1-ylethyl)amino]-N-(2-chlorophenyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CN(CCN1CCCC1)Cc1ccccc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H26ClN3O.2ClH/c22-19-10-4-5-11-20(19)23-21(26)17-25(15-14-24-12-6-7-13-24)16-18-8-2-1-3-9-18;;/h1-5,8-11H,6-7,12-17H2,(H,23,26);2*1H |
| InChIKey | SMZWYAFASDSUIA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |