About trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride
trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride (PubChem CID 11971658) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride.
Molecular Properties
| Compound Name | trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride |
| PubChem CID | 11971658 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride |
| SMILES | CC1OCC(C[N+](C)(C)C)O1.[Cl-] |
| InChI | InChI=1S/C8H18NO2.ClH/c1-7-10-6-8(11-7)5-9(2,3)4;/h7-8H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SLKQVBSSOGUUIO-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride?
The IUPAC name of trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride (CID 11971658) is trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride.
What is the SMILES notation for trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride?
The canonical SMILES for trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride is CC1OCC(C[N+](C)(C)C)O1.[Cl-].
What is the InChIKey of trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride?
The InChIKey is SLKQVBSSOGUUIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18NO2.ClH/c1-7-10-6-8(11-7)5-9(2,3)4;/h7-8H,5-6H2,1-4H3;1H/q+1;/p-1.
What are the key properties of trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride?
trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride has a molecular weight of 195.69 g/mol, XLogP of -2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2-methyl-1,3-dioxolan-4-yl)methyl]azanium chloride is sourced from PubChem (CID 11971658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).