C19H23N3O2 — CID 119716862
4-amino-N-[[3-(2-methylbutanoylamino)phenyl]methyl]benzamide (PubChem CID 119716862) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-amino-N-[[3-(2-methylbutanoylamino)phenyl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-(2-methylbutanoylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 119716862 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-amino-N-[[3-(2-methylbutanoylamino)phenyl]methyl]benzamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNC(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-3-13(2)18(23)22-17-6-4-5-14(11-17)12-21-19(24)15-7-9-16(20)10-8-15/h4-11,13H,3,12,20H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | CFTZVNUBEKARGK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|