About 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride
1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride (PubChem CID 11971743) has the molecular formula C18H40ClN5
and a molecular weight of 362.01 g/mol. Its IUPAC name is 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride |
| PubChem CID | 11971743 |
| Molecular Formula | C18H40ClN5 |
| Molecular Weight | 362.01 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(\N)N(CCCC)CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C18H39N5.ClH/c1-5-9-13-22(14-10-6-2)17(19)21-18(20)23(15-11-7-3)16-12-8-4;/h5-16H2,1-4H3,(H3,19,20,21);1H |
| InChIKey | FDDKNYAPYWGLSS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride?
The IUPAC name of 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride (CID 11971743) is 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride.
What is the SMILES notation for 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride?
The canonical SMILES for 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride is Cl.[H]/N=C(/N=C(\N)N(CCCC)CCCC)N(CCCC)CCCC.
What is the InChIKey of 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride?
The InChIKey is FDDKNYAPYWGLSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N5.ClH/c1-5-9-13-22(14-10-6-2)17(19)21-18(20)23(15-11-7-3)16-12-8-4;/h5-16H2,1-4H3,(H3,19,20,21);1H.
What are the key properties of 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride?
1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride has a molecular weight of 362.01 g/mol, XLogP of 4.46, 12 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutyl-2-(N,N-dibutylcarbamimidoyl)guanidine;hydrochloride is sourced from PubChem (CID 11971743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).