C21H29ClN2O2 — CID 119718098
2-amino-2-methyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]pentanamide;hydrochloride (PubChem CID 119718098) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-2-methyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119718098 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-amino-2-methyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]pentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCc1ccccc1COCc1ccccc1.Cl |
| InChI | InChI=1S/C21H28N2O2.ClH/c1-3-13-21(2,22)20(24)23-14-18-11-7-8-12-19(18)16-25-15-17-9-5-4-6-10-17;/h4-12H,3,13-16,22H2,1-2H3,(H,23,24);1H |
| InChIKey | YCJQTKFEZDKLBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |