C15H19ClFN3O2S — CID 119718760
N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119718760) has the molecular formula C15H19ClFN3O2S and a molecular weight of 359.85 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119718760 |
| Molecular Formula | C15H19ClFN3O2S |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ncc(Cc2ccccc2F)s1.Cl |
| InChI | InChI=1S/C15H18FN3O2S.ClH/c1-21-7-6-17-10-14(20)19-15-18-9-12(22-15)8-11-4-2-3-5-13(11)16;/h2-5,9,17H,6-8,10H2,1H3,(H,18,19,20);1H |
| InChIKey | SDTYXOMBRVEUTE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|