C21H32ClN3O2 — CID 119719350
N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119719350) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119719350 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NC(CN1CCCC1=O)c1ccccc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H31N3O2.ClH/c1-16(17-9-11-22-12-10-17)14-20(25)23-19(18-6-3-2-4-7-18)15-24-13-5-8-21(24)26;/h2-4,6-7,16-17,19,22H,5,8-15H2,1H3,(H,23,25);1H |
| InChIKey | QKKKKFYGYXJEDN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |