C19H29N3O3S — CID 119720516
N-[4-(cyclopropylmethylsulfamoyl)phenyl]-3-piperidin-4-ylbutanamide (PubChem CID 119720516) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[4-(cyclopropylmethylsulfamoyl)phenyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119720516 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)Nc1ccc(S(=O)(=O)NCC2CC2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-14(16-8-10-20-11-9-16)12-19(23)22-17-4-6-18(7-5-17)26(24,25)21-13-15-2-3-15/h4-7,14-16,20-21H,2-3,8-13H2,1H3,(H,22,23) |
| InChIKey | OYEUENQQEGIXCB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |