C18H25N3O3 — CID 119720950
N-[1-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 119720950) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[1-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[1-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119720950 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[1-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCNC1)c1ccc(OCC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-12(20-18(23)14-8-9-19-10-14)13-2-6-16(7-3-13)24-11-17(22)21-15-4-5-15/h2-3,6-7,12,14-15,19H,4-5,8-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | TWSLUFMMSPUABF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |