About [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone
[1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 1197211) has the molecular formula C20H30N4OS
and a molecular weight of 374.55 g/mol. Its IUPAC name is [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone |
| PubChem CID | 1197211 |
| Molecular Formula | C20H30N4OS |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCCc1c(C(=O)N2CCC(C)CC2)cnn1-c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C20H30N4OS/c1-6-7-16-15(18(25)23-10-8-14(2)9-11-23)12-21-24(16)19-22-17(13-26-19)20(3,4)5/h12-14H,6-11H2,1-5H3 |
| InChIKey | GPWSNGDBTCDKBQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone?
The IUPAC name of [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone (CID 1197211) is [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone.
What is the SMILES notation for [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone?
The canonical SMILES for [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone is CCCc1c(C(=O)N2CCC(C)CC2)cnn1-c1nc(C(C)(C)C)cs1.
What is the InChIKey of [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone?
The InChIKey is GPWSNGDBTCDKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4OS/c1-6-7-16-15(18(25)23-10-8-14(2)9-11-23)12-21-24(16)19-22-17(13-26-19)20(3,4)5/h12-14H,6-11H2,1-5H3.
What are the key properties of [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone?
[1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone has a molecular weight of 374.55 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-tert-butyl-1,3-thiazol-2-yl)-5-propylpyrazol-4-yl]-(4-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 1197211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).