C19H28N2O4 — CID 119721132
N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]morpholine-3-carboxamide (PubChem CID 119721132) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]morpholine-3-carboxamide.
| Compound Name | N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119721132 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]morpholine-3-carboxamide |
| SMILES | COc1cc(C(C)NC(=O)C2COCCN2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C19H28N2O4/c1-13(21-19(22)16-12-24-10-9-20-16)14-7-8-17(18(11-14)23-2)25-15-5-3-4-6-15/h7-8,11,13,15-16,20H,3-6,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | NWOKVVDTEXPVKL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |