C15H25ClN4O2 — CID 119721981
2-amino-N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-methylpentanamide;hydrochloride (PubChem CID 119721981) has the molecular formula C15H25ClN4O2 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-amino-N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119721981 |
| Molecular Formula | C15H25ClN4O2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-amino-N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NC(C)c1ccc(NC(N)=O)cc1.Cl |
| InChI | InChI=1S/C15H24N4O2.ClH/c1-4-9(2)13(16)14(20)18-10(3)11-5-7-12(8-6-11)19-15(17)21;/h5-10,13H,4,16H2,1-3H3,(H,18,20)(H3,17,19,21);1H |
| InChIKey | YTNJCKVCLKZYGZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |