C8H15N5 — CID 11972200
2-N-(3-methylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 11972200) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-N-(3-methylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11972200 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-N-(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CCNc1ncnc(N)n1 |
| InChI | InChI=1S/C8H15N5/c1-6(2)3-4-10-8-12-5-11-7(9)13-8/h5-6H,3-4H2,1-2H3,(H3,9,10,11,12,13) |
| InChIKey | PFVQOSSDDOMOQK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |