C23H28N4O2 — CID 119722000
3-amino-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119722000) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-amino-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119722000 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-amino-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(NC(=O)C1C2CCC(C2)C1N)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-14(25-22(28)20-16-7-8-17(13-16)21(20)24)15-9-11-19(12-10-15)27-23(29)26-18-5-3-2-4-6-18/h2-6,9-12,14,16-17,20-21H,7-8,13,24H2,1H3,(H,25,28)(H2,26,27,29) |
| InChIKey | NOOVLRLIPKWGLW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |