About 2-iminopyridin-1-amine
2-iminopyridin-1-amine (PubChem CID 11972264) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is 2-iminopyridin-1-amine.
Molecular Properties
| Compound Name | 2-iminopyridin-1-amine |
| PubChem CID | 11972264 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 2-iminopyridin-1-amine |
| SMILES | [H]/N=c1\ccccn1N |
| InChI | InChI=1S/C5H7N3/c6-5-3-1-2-4-8(5)7/h1-4,6H,7H2/b6-5+ |
| InChIKey | CTVDPRQKVHCUBZ-AATRIKPKSA-N |
| XLogP | -0.32 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-iminopyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopyridin-1-amine?
The IUPAC name of 2-iminopyridin-1-amine (CID 11972264) is 2-iminopyridin-1-amine.
What is the SMILES notation for 2-iminopyridin-1-amine?
The canonical SMILES for 2-iminopyridin-1-amine is [H]/N=c1\ccccn1N.
What is the InChIKey of 2-iminopyridin-1-amine?
The InChIKey is CTVDPRQKVHCUBZ-AATRIKPKSA-N. The full InChI is InChI=1S/C5H7N3/c6-5-3-1-2-4-8(5)7/h1-4,6H,7H2/b6-5+.
What are the key properties of 2-iminopyridin-1-amine?
2-iminopyridin-1-amine has a molecular weight of 109.13 g/mol, XLogP of -0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopyridin-1-amine is sourced from PubChem (CID 11972264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).