C15H24ClN3O3S — CID 119723679
N-[2-(benzylsulfamoyl)ethyl]-2-(cyclopropylmethylamino)acetamide;hydrochloride (PubChem CID 119723679) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-2-(cyclopropylmethylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-2-(cyclopropylmethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119723679 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-2-(cyclopropylmethylamino)acetamide;hydrochloride |
| SMILES | Cl.O=C(CNCC1CC1)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H23N3O3S.ClH/c19-15(12-16-10-14-6-7-14)17-8-9-22(20,21)18-11-13-4-2-1-3-5-13;/h1-5,14,16,18H,6-12H2,(H,17,19);1H |
| InChIKey | UJYPTDBLPOPCMA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |