C17H25ClN4O — CID 119725260
7-amino-N-[(4-pyrazol-1-ylphenyl)methyl]heptanamide;hydrochloride (PubChem CID 119725260) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is 7-amino-N-[(4-pyrazol-1-ylphenyl)methyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[(4-pyrazol-1-ylphenyl)methyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119725260 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 7-amino-N-[(4-pyrazol-1-ylphenyl)methyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H24N4O.ClH/c18-11-4-2-1-3-6-17(22)19-14-15-7-9-16(10-8-15)21-13-5-12-20-21;/h5,7-10,12-13H,1-4,6,11,14,18H2,(H,19,22);1H |
| InChIKey | KDEQHAIZLDREJR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|