C11H20ClN3O2 — CID 119726913
1-(2-pyrrolidin-2-ylacetyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119726913) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-(2-pyrrolidin-2-ylacetyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(2-pyrrolidin-2-ylacetyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119726913 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-(2-pyrrolidin-2-ylacetyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCCN1C(=O)CC1CCCN1 |
| InChI | InChI=1S/C11H19N3O2.ClH/c12-11(16)9-4-2-6-14(9)10(15)7-8-3-1-5-13-8;/h8-9,13H,1-7H2,(H2,12,16);1H |
| InChIKey | UPAQCIVOBLSLKB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |