C12H21ClN2O — CID 119726919
3-amino-N-cyclobutylbicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119726919) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 3-amino-N-cyclobutylbicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-cyclobutylbicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119726919 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-amino-N-cyclobutylbicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCC(C2)C1C(=O)NC1CCC1 |
| InChI | InChI=1S/C12H20N2O.ClH/c13-11-8-5-4-7(6-8)10(11)12(15)14-9-2-1-3-9;/h7-11H,1-6,13H2,(H,14,15);1H |
| InChIKey | DECMTWJLYLEZLP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |