C17H24ClN3O4 — CID 119727479
(4-hydroxypyrrolidin-2-yl)-[4-(3-methoxybenzoyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119727479) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is (4-hydroxypyrrolidin-2-yl)-[4-(3-methoxybenzoyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (4-hydroxypyrrolidin-2-yl)-[4-(3-methoxybenzoyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119727479 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (4-hydroxypyrrolidin-2-yl)-[4-(3-methoxybenzoyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)C3CC(O)CN3)CC2)c1.Cl |
| InChI | InChI=1S/C17H23N3O4.ClH/c1-24-14-4-2-3-12(9-14)16(22)19-5-7-20(8-6-19)17(23)15-10-13(21)11-18-15;/h2-4,9,13,15,18,21H,5-8,10-11H2,1H3;1H |
| InChIKey | NKNSDFFFHLONKS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |