C16H30ClN3O2 — CID 119728333
N-[4-(cyclopropylamino)-4-oxobutyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119728333) has the molecular formula C16H30ClN3O2 and a molecular weight of 331.89 g/mol. Its IUPAC name is N-[4-(cyclopropylamino)-4-oxobutyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[4-(cyclopropylamino)-4-oxobutyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119728333 |
| Molecular Formula | C16H30ClN3O2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[4-(cyclopropylamino)-4-oxobutyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCCC(=O)NC1CC1)C1CCCNC1.Cl |
| InChI | InChI=1S/C16H29N3O2.ClH/c1-12(13-4-2-8-17-11-13)10-16(21)18-9-3-5-15(20)19-14-6-7-14;/h12-14,17H,2-11H2,1H3,(H,18,21)(H,19,20);1H |
| InChIKey | GUFJCGFJJQKUGW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|