C17H27N3O3 — CID 119729089
2-amino-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylpentanamide (PubChem CID 119729089) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-amino-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylpentanamide.
| Compound Name | 2-amino-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 119729089 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-amino-N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)N(CC)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-5-10-17(3,18)16(22)20(6-2)12-15(21)19-13-8-7-9-14(11-13)23-4/h7-9,11H,5-6,10,12,18H2,1-4H3,(H,19,21) |
| InChIKey | HDJQSKKXKXFGCM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |