C13H18Cl2N2O2 — CID 119729193
(4-amino-2-chlorophenyl)-(2,5-dimethylmorpholin-4-yl)methanone;hydrochloride (PubChem CID 119729193) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-(2,5-dimethylmorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (4-amino-2-chlorophenyl)-(2,5-dimethylmorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119729193 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (4-amino-2-chlorophenyl)-(2,5-dimethylmorpholin-4-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2ccc(N)cc2Cl)C(C)CO1.Cl |
| InChI | InChI=1S/C13H17ClN2O2.ClH/c1-8-7-18-9(2)6-16(8)13(17)11-4-3-10(15)5-12(11)14;/h3-5,8-9H,6-7,15H2,1-2H3;1H |
| InChIKey | KWNFYVPTSPDIDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|