C17H34N4O3S — CID 119729438
4-(2-amino-3-methylpentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide (PubChem CID 119729438) has the molecular formula C17H34N4O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is 4-(2-amino-3-methylpentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide.
| Compound Name | 4-(2-amino-3-methylpentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 119729438 |
| Molecular Formula | C17H34N4O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 4-(2-amino-3-methylpentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
| SMILES | CCC(C)C(N)C(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H34N4O3S/c1-4-14(2)16(18)17(22)20-10-12-21(13-11-20)25(23,24)19(3)15-8-6-5-7-9-15/h14-16H,4-13,18H2,1-3H3 |
| InChIKey | BZHABAMDQLEOAA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |