C15H22ClFN2O2 — CID 119729459
2-amino-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119729459) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 2-amino-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119729459 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-amino-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | COc1ccc(F)cc1C(C)NC(=O)C1CCCC1N.Cl |
| InChI | InChI=1S/C15H21FN2O2.ClH/c1-9(12-8-10(16)6-7-14(12)20-2)18-15(19)11-4-3-5-13(11)17;/h6-9,11,13H,3-5,17H2,1-2H3,(H,18,19);1H |
| InChIKey | DOPBVUWENXXEQH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |