C18H28ClN3O2 — CID 119729777
7-amino-N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]heptanamide;hydrochloride (PubChem CID 119729777) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 7-amino-N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119729777 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 7-amino-N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]heptanamide;hydrochloride |
| SMILES | CC(NC(=O)CCCCCCN)c1ccc2c(c1)CCC(=O)N2.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-13(20-17(22)6-4-2-3-5-11-19)14-7-9-16-15(12-14)8-10-18(23)21-16;/h7,9,12-13H,2-6,8,10-11,19H2,1H3,(H,20,22)(H,21,23);1H |
| InChIKey | YIQWSILYEXZWQQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|