C17H16F2O — CID 11973037
(1S,2S,3S,5R,6R,7R,8R,9S,10R)-11,11-difluoro-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol (PubChem CID 11973037) has the molecular formula C17H16F2O and a molecular weight of 274.31 g/mol. Its IUPAC name is (1S,2S,3S,5R,6R,7R,8R,9S,10R)-11,11-difluoro-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol.
| Compound Name | (1S,2S,3S,5R,6R,7R,8R,9S,10R)-11,11-difluoro-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
|---|---|
| PubChem CID | 11973037 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (1S,2S,3S,5R,6R,7R,8R,9S,10R)-11,11-difluoro-8-phenylpentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
| SMILES | O[C@@]1(c2ccccc2)[C@@H]2[C@@H]3[C@H]4C[C@H]5[C@@H]3[C@@H]2C(F)(F)[C@H]5[C@H]41 |
| InChI | InChI=1S/C17H16F2O/c18-17(19)13-9-6-8-10-11(9)15(17)14(10)16(20,12(8)13)7-4-2-1-3-5-7/h1-5,8-15,20H,6H2/t8-,9+,10-,11+,12+,13-,14-,15+,16-/m1/s1 |
| InChIKey | YEEPAVCGRNCSTQ-RDVZOTNNSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |