C15H21FN2O — CID 119731221
N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119731221) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119731221 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)NCC1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H21FN2O/c1-11(9-17-2)14(19)18-10-15(7-8-15)12-3-5-13(16)6-4-12/h3-6,11,17H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | PTOIJHOSWQTOFN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |