C17H24Cl3N3O3 — CID 119731326
N-(2,4-dichlorophenyl)-1-[2-(2-methoxyethylamino)acetyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119731326) has the molecular formula C17H24Cl3N3O3 and a molecular weight of 424.76 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-[2-(2-methoxyethylamino)acetyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-(2,4-dichlorophenyl)-1-[2-(2-methoxyethylamino)acetyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119731326 |
| Molecular Formula | C17H24Cl3N3O3 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-[2-(2-methoxyethylamino)acetyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | COCCNCC(=O)N1CCCCC1C(=O)Nc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C17H23Cl2N3O3.ClH/c1-25-9-7-20-11-16(23)22-8-3-2-4-15(22)17(24)21-14-6-5-12(18)10-13(14)19;/h5-6,10,15,20H,2-4,7-9,11H2,1H3,(H,21,24);1H |
| InChIKey | OKTUPNIQLQUNBV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|