C11H18BrClN2OS — CID 119731588
2-amino-N-[(4-bromothiophen-2-yl)methyl]-3-methylpentanamide;hydrochloride (PubChem CID 119731588) has the molecular formula C11H18BrClN2OS and a molecular weight of 341.70 g/mol. Its IUPAC name is 2-amino-N-[(4-bromothiophen-2-yl)methyl]-3-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119731588 |
| Molecular Formula | C11H18BrClN2OS |
| Molecular Weight | 341.70 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NCc1cc(Br)cs1.Cl |
| InChI | InChI=1S/C11H17BrN2OS.ClH/c1-3-7(2)10(13)11(15)14-5-9-4-8(12)6-16-9;/h4,6-7,10H,3,5,13H2,1-2H3,(H,14,15);1H |
| InChIKey | HMTJLRUMBZPBBB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |