C16H27ClN2O3 — CID 119732105
N-[1-[3-methoxy-4-(2-methylpropoxy)phenyl]ethyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119732105) has the molecular formula C16H27ClN2O3 and a molecular weight of 330.86 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(2-methylpropoxy)phenyl]ethyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[1-[3-methoxy-4-(2-methylpropoxy)phenyl]ethyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119732105 |
| Molecular Formula | C16H27ClN2O3 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[1-[3-methoxy-4-(2-methylpropoxy)phenyl]ethyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NC(C)c1ccc(OCC(C)C)c(OC)c1.Cl |
| InChI | InChI=1S/C16H26N2O3.ClH/c1-11(2)10-21-14-7-6-13(8-15(14)20-5)12(3)18-16(19)9-17-4;/h6-8,11-12,17H,9-10H2,1-5H3,(H,18,19);1H |
| InChIKey | DBYYEYRGAJLNCZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |