C15H21ClF3N3O3 — CID 119732278
2,2,2-trifluoro-N-[[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]methyl]-N-methylacetamide;hydrochloride (PubChem CID 119732278) has the molecular formula C15H21ClF3N3O3 and a molecular weight of 383.80 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]methyl]-N-methylacetamide;hydrochloride.
| Compound Name | 2,2,2-trifluoro-N-[[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]methyl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119732278 |
| Molecular Formula | C15H21ClF3N3O3 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]methyl]-N-methylacetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cccc(CN(C)C(=O)C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C15H20F3N3O3.ClH/c1-21(14(23)15(16,17)18)10-11-4-3-5-12(8-11)20-13(22)9-19-6-7-24-2;/h3-5,8,19H,6-7,9-10H2,1-2H3,(H,20,22);1H |
| InChIKey | LZZSGYFGJYBMMF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|