C14H23ClN2O — CID 119732292
2-(4-aminophenyl)-N-ethyl-N-(2-methylpropyl)acetamide;hydrochloride (PubChem CID 119732292) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-ethyl-N-(2-methylpropyl)acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-ethyl-N-(2-methylpropyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119732292 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-ethyl-N-(2-methylpropyl)acetamide;hydrochloride |
| SMILES | CCN(CC(C)C)C(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C14H22N2O.ClH/c1-4-16(10-11(2)3)14(17)9-12-5-7-13(15)8-6-12;/h5-8,11H,4,9-10,15H2,1-3H3;1H |
| InChIKey | IZSYQGFWDTZJOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|