C28H47NO7 — CID 11973254
(1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R,18S)-11-ethyl-4,6,8,9,16,18-hexamethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane (PubChem CID 11973254) has the molecular formula C28H47NO7 and a molecular weight of 509.68 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R,18S)-11-ethyl-4,6,8,9,16,18-hexamethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane.
| Compound Name | (1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R,18S)-11-ethyl-4,6,8,9,16,18-hexamethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane |
|---|---|
| PubChem CID | 11973254 |
| Molecular Formula | C28H47NO7 |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | (1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R,18S)-11-ethyl-4,6,8,9,16,18-hexamethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@]34[C@@H]5C[C@H]6[C@H](OC)[C@@H]5[C@](OC)(C[C@@H]6OC)[C@](OC)([C@H]13)[C@@H](OC)[C@H]24 |
| InChI | InChI=1S/C28H47NO7/c1-9-29-14-25(15-30-2)11-10-19(32-4)27-17-12-16-18(31-3)13-26(35-7,20(17)21(16)33-5)28(36-8,24(27)29)23(34-6)22(25)27/h16-24H,9-15H2,1-8H3/t16-,17-,18+,19+,20-,21+,22-,23+,24-,25+,26-,27+,28-/m1/s1 |
| InChIKey | MHWWCILKLVKDNY-BHKLHCDXSA-N |
| XLogP | 2.23 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |