C35H52O4S — CID 11973345
(2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-ol (PubChem CID 11973345) has the molecular formula C35H52O4S and a molecular weight of 568.86 g/mol. Its IUPAC name is (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-ol.
| Compound Name | (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-ol |
|---|---|
| PubChem CID | 11973345 |
| Molecular Formula | C35H52O4S |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | (2S,3R)-4-(benzenesulfonyl)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methyl-5-methylideneheptan-3-ol |
| SMILES | C=C(C(C)C)C([C@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](OC)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H52O4S/c1-21(2)22(3)32(40(37,38)25-11-9-8-10-12-25)31(36)23(4)27-13-14-28-26-19-30(39-7)35-20-24(35)15-18-34(35,6)29(26)16-17-33(27,28)5/h8-12,21,23-24,26-32,36H,3,13-20H2,1-2,4-7H3/t23-,24+,26-,27+,28-,29-,30+,31+,32?,33+,34+,35-/m0/s1 |
| InChIKey | VLRZBFRFUOFEBI-WLISPXFSSA-N |
| XLogP | 7.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|