C12H23ClN2O3 — CID 119733666
methyl 4-methyl-1-[[2-(methylamino)acetyl]amino]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 119733666) has the molecular formula C12H23ClN2O3 and a molecular weight of 278.78 g/mol. Its IUPAC name is methyl 4-methyl-1-[[2-(methylamino)acetyl]amino]cyclohexane-1-carboxylate;hydrochloride.
| Compound Name | methyl 4-methyl-1-[[2-(methylamino)acetyl]amino]cyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119733666 |
| Molecular Formula | C12H23ClN2O3 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl 4-methyl-1-[[2-(methylamino)acetyl]amino]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | CNCC(=O)NC1(C(=O)OC)CCC(C)CC1.Cl |
| InChI | InChI=1S/C12H22N2O3.ClH/c1-9-4-6-12(7-5-9,11(16)17-3)14-10(15)8-13-2;/h9,13H,4-8H2,1-3H3,(H,14,15);1H |
| InChIKey | UFITYCQJGBCBFR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |