C14H25ClN2O2 — CID 119733982
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(3-methylpyrrolidin-3-yl)methanone;hydrochloride (PubChem CID 119733982) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(3-methylpyrrolidin-3-yl)methanone;hydrochloride.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(3-methylpyrrolidin-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119733982 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(3-methylpyrrolidin-3-yl)methanone;hydrochloride |
| SMILES | CC1(C(=O)N2CCOC3CCCCC32)CCNC1.Cl |
| InChI | InChI=1S/C14H24N2O2.ClH/c1-14(6-7-15-10-14)13(17)16-8-9-18-12-5-3-2-4-11(12)16;/h11-12,15H,2-10H2,1H3;1H |
| InChIKey | KDSIAHHGLSCCOV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |