C19H22N4O2 — CID 119736029
N-[2-[[2-(4-aminophenyl)acetyl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 119736029) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-[[2-(4-aminophenyl)acetyl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[[2-(4-aminophenyl)acetyl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 119736029 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[2-[[2-(4-aminophenyl)acetyl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | Nc1ccc(CC(=O)Nc2ccccc2NC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c20-15-9-7-14(8-10-15)13-18(24)21-16-5-1-2-6-17(16)22-19(25)23-11-3-4-12-23/h1-2,5-10H,3-4,11-13,20H2,(H,21,24)(H,22,25) |
| InChIKey | RDWTYAWZXXQIHQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|