C16H20ClN3OS — CID 119736978
N-[5-[(3-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-4-(methylamino)butanamide (PubChem CID 119736978) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-4-(methylamino)butanamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119736978 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1nc(C)c(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-11-14(10-12-5-3-6-13(17)9-12)22-16(19-11)20-15(21)7-4-8-18-2/h3,5-6,9,18H,4,7-8,10H2,1-2H3,(H,19,20,21) |
| InChIKey | QNQYTUBPVUTUJK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|